C30H32O6 — CID 145332173
4-methyl-7-[4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]oxy-3,4-dihydrochromen-2-one (PubChem CID 145332173) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is 4-methyl-7-[4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]oxy-3,4-dihydrochromen-2-one.
| Compound Name | 4-methyl-7-[4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]oxy-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 145332173 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 4-methyl-7-[4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]oxy-3,4-dihydrochromen-2-one |
| SMILES | CC1CC(=O)Oc2cc(OC3CC(OCc4ccccc4)CC(COCc4ccccc4)O3)ccc21 |
| InChI | InChI=1S/C30H32O6/c1-21-14-29(31)36-28-16-24(12-13-27(21)28)34-30-17-25(33-19-23-10-6-3-7-11-23)15-26(35-30)20-32-18-22-8-4-2-5-9-22/h2-13,16,21,25-26,30H,14-15,17-20H2,1H3 |
| InChIKey | GSGPWSGLLYHOKZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|