C36H40O6 — CID 142291511
ethane;[4-[4-methyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl] benzoate (PubChem CID 142291511) has the molecular formula C36H40O6 and a molecular weight of 568.71 g/mol. Its IUPAC name is ethane;[4-[4-methyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl] benzoate.
| Compound Name | ethane;[4-[4-methyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl] benzoate |
|---|---|
| PubChem CID | 142291511 |
| Molecular Formula | C36H40O6 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | ethane;[4-[4-methyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl] benzoate |
| SMILES | CC.CC1CC(Oc2ccc(OC(=O)c3ccccc3)cc2)OC(COCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C34H34O6.C2H6/c1-25-21-32(38-29-17-19-30(20-18-29)39-34(35)28-15-9-4-10-16-28)40-31(24-36-22-26-11-5-2-6-12-26)33(25)37-23-27-13-7-3-8-14-27;1-2/h2-20,25,31-33H,21-24H2,1H3;1-2H3 |
| InChIKey | RBJDWKQJPMKBCB-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|