C33H32O7 — CID 142291509
[4-[4-hydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl] benzoate (PubChem CID 142291509) has the molecular formula C33H32O7 and a molecular weight of 540.61 g/mol. Its IUPAC name is [4-[4-hydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl] benzoate.
| Compound Name | [4-[4-hydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl] benzoate |
|---|---|
| PubChem CID | 142291509 |
| Molecular Formula | C33H32O7 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | [4-[4-hydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl] benzoate |
| SMILES | O=C(Oc1ccc(OC2CC(O)C(OCc3ccccc3)C(COCc3ccccc3)O2)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H32O7/c34-29-20-31(38-27-16-18-28(19-17-27)39-33(35)26-14-8-3-9-15-26)40-30(23-36-21-24-10-4-1-5-11-24)32(29)37-22-25-12-6-2-7-13-25/h1-19,29-32,34H,20-23H2 |
| InChIKey | WFQAXAUBQCKRNG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|