C35H50O7Si — CID 11966508
methyl (E)-4-[(2R,3S,4aR,6S,8S,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-8-phenylmethoxy-6-(phenylmethoxymethyl)-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-yl]but-2-enoate (PubChem CID 11966508) has the molecular formula C35H50O7Si and a molecular weight of 610.86 g/mol. Its IUPAC name is methyl (E)-4-[(2R,3S,4aR,6S,8S,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-8-phenylmethoxy-6-(phenylmethoxymethyl)-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-yl]but-2-enoate.
| Compound Name | methyl (E)-4-[(2R,3S,4aR,6S,8S,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-8-phenylmethoxy-6-(phenylmethoxymethyl)-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 11966508 |
| Molecular Formula | C35H50O7Si |
| Molecular Weight | 610.86 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | methyl (E)-4-[(2R,3S,4aR,6S,8S,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-8-phenylmethoxy-6-(phenylmethoxymethyl)-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-yl]but-2-enoate |
| SMILES | COC(=O)/C=C/C[C@@]1(C)O[C@H]2[C@@H](OCc3ccccc3)C[C@@H](COCc3ccccc3)O[C@@H]2C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H50O7Si/c1-34(2,3)43(6,7)42-31-22-30-33(41-35(31,4)20-14-19-32(36)37-5)29(39-24-27-17-12-9-13-18-27)21-28(40-30)25-38-23-26-15-10-8-11-16-26/h8-19,28-31,33H,20-25H2,1-7H3/b19-14+/t28-,29-,30+,31-,33-,35+/m0/s1 |
| InChIKey | HWCZIFHPBBYJMI-HFRRHPCQSA-N |
| XLogP | 7.00 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.86 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|