C36H50O7Si — CID 11296545
methyl (E)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[(2S,3R,5Z,8S,9R)-2-ethenyl-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,3,4,7,8,9-hexahydrooxonin-3-yl]oxy]but-2-enoate (PubChem CID 11296545) has the molecular formula C36H50O7Si and a molecular weight of 622.88 g/mol. Its IUPAC name is methyl (E)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[(2S,3R,5Z,8S,9R)-2-ethenyl-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,3,4,7,8,9-hexahydrooxonin-3-yl]oxy]but-2-enoate.
| Compound Name | methyl (E)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[(2S,3R,5Z,8S,9R)-2-ethenyl-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,3,4,7,8,9-hexahydrooxonin-3-yl]oxy]but-2-enoate |
|---|---|
| PubChem CID | 11296545 |
| Molecular Formula | C36H50O7Si |
| Molecular Weight | 622.88 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | methyl (E)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[(2S,3R,5Z,8S,9R)-2-ethenyl-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,3,4,7,8,9-hexahydrooxonin-3-yl]oxy]but-2-enoate |
| SMILES | C=C[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)C/C=C\C[C@H]1O/C(=C/C(=O)OC)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H50O7Si/c1-8-31-33(42-30(23-35(37)38-5)26-41-44(6,7)36(2,3)4)22-16-15-21-32(40-25-29-19-13-10-14-20-29)34(43-31)27-39-24-28-17-11-9-12-18-28/h8-20,23,31-34H,1,21-22,24-27H2,2-7H3/b16-15-,30-23+/t31-,32-,33+,34+/m0/s1 |
| InChIKey | XXTKLKNCBKGXPS-RDFDYKIVSA-N |
| XLogP | 7.54 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.88 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|