C36H52O6Si — CID 101349446
(E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[(2S,3R,5Z,8S,9R)-2-ethenyl-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,3,4,7,8,9-hexahydrooxonin-3-yl]oxy]pent-2-en-1-ol (PubChem CID 101349446) has the molecular formula C36H52O6Si and a molecular weight of 608.89 g/mol. Its IUPAC name is (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[(2S,3R,5Z,8S,9R)-2-ethenyl-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,3,4,7,8,9-hexahydrooxonin-3-yl]oxy]pent-2-en-1-ol.
| Compound Name | (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[(2S,3R,5Z,8S,9R)-2-ethenyl-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,3,4,7,8,9-hexahydrooxonin-3-yl]oxy]pent-2-en-1-ol |
|---|---|
| PubChem CID | 101349446 |
| Molecular Formula | C36H52O6Si |
| Molecular Weight | 608.89 g/mol |
| Exact Mass | 608.35 |
| IUPAC Name | (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[(2S,3R,5Z,8S,9R)-2-ethenyl-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,3,4,7,8,9-hexahydrooxonin-3-yl]oxy]pent-2-en-1-ol |
| SMILES | C=C[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)C/C=C\C[C@H]1O[C@H](/C=C/CO)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H52O6Si/c1-7-32-34(41-31(21-16-24-37)27-40-43(5,6)36(2,3)4)23-15-14-22-33(39-26-30-19-12-9-13-20-30)35(42-32)28-38-25-29-17-10-8-11-18-29/h7-21,31-35,37H,1,22-28H2,2-6H3/b15-14-,21-16+/t31-,32+,33+,34-,35-/m1/s1 |
| InChIKey | AYNCLPFHEITGOB-PHBUUBNPSA-N |
| XLogP | 7.40 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.89 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|