C37H38O5 — CID 102262531
(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-propa-1,2-dienyloxane (PubChem CID 102262531) has the molecular formula C37H38O5 and a molecular weight of 562.71 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-propa-1,2-dienyloxane.
| Compound Name | (2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-propa-1,2-dienyloxane |
|---|---|
| PubChem CID | 102262531 |
| Molecular Formula | C37H38O5 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | (2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-propa-1,2-dienyloxane |
| SMILES | C=C=C[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H38O5/c1-2-15-33-35(39-25-30-18-9-4-10-19-30)37(41-27-32-22-13-6-14-23-32)36(40-26-31-20-11-5-12-21-31)34(42-33)28-38-24-29-16-7-3-8-17-29/h3-23,33-37H,1,24-28H2/t33-,34-,35+,36+,37-/m1/s1 |
| InChIKey | QTKAIUIQJUXIAG-GDWCTEMXSA-N |
| XLogP | 7.07 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |