C21H35ClN2O3Si — CID 90886951
[1-benzyl-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl] N-(2-chloroethyl)carbamate (PubChem CID 90886951) has the molecular formula C21H35ClN2O3Si and a molecular weight of 427.06 g/mol. Its IUPAC name is [1-benzyl-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl] N-(2-chloroethyl)carbamate.
| Compound Name | [1-benzyl-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl] N-(2-chloroethyl)carbamate |
|---|---|
| PubChem CID | 90886951 |
| Molecular Formula | C21H35ClN2O3Si |
| Molecular Weight | 427.06 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | [1-benzyl-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl] N-(2-chloroethyl)carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OC1CN(Cc2ccccc2)CCC1OC(=O)NCCCl |
| InChI | InChI=1S/C21H35ClN2O3Si/c1-21(2,3)28(4,5)27-19-16-24(15-17-9-7-6-8-10-17)14-11-18(19)26-20(25)23-13-12-22/h6-10,18-19H,11-16H2,1-5H3,(H,23,25) |
| InChIKey | XRVNBWRMKLNPMK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.06 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|