C27H35N3O2 — CID 70818676
[1-benzyl-3-[[4-(2-cyanoethyl)phenyl]methyl]piperidin-4-yl] N-tert-butylcarbamate (PubChem CID 70818676) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is [1-benzyl-3-[[4-(2-cyanoethyl)phenyl]methyl]piperidin-4-yl] N-tert-butylcarbamate.
| Compound Name | [1-benzyl-3-[[4-(2-cyanoethyl)phenyl]methyl]piperidin-4-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 70818676 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | [1-benzyl-3-[[4-(2-cyanoethyl)phenyl]methyl]piperidin-4-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CCN(Cc2ccccc2)CC1Cc1ccc(CCC#N)cc1 |
| InChI | InChI=1S/C27H35N3O2/c1-27(2,3)29-26(31)32-25-15-17-30(19-23-8-5-4-6-9-23)20-24(25)18-22-13-11-21(12-14-22)10-7-16-28/h4-6,8-9,11-14,24-25H,7,10,15,17-20H2,1-3H3,(H,29,31) |
| InChIKey | MAKDMSNYYCWDPS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |