C18H25N3O2 — CID 155294397
tert-butyl N-[(3S,4R)-1-benzyl-3-cyanopiperidin-4-yl]carbamate (PubChem CID 155294397) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R)-1-benzyl-3-cyanopiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4R)-1-benzyl-3-cyanopiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 155294397 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | tert-butyl N-[(3S,4R)-1-benzyl-3-cyanopiperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(Cc2ccccc2)C[C@@H]1C#N |
| InChI | InChI=1S/C18H25N3O2/c1-18(2,3)23-17(22)20-16-9-10-21(13-15(16)11-19)12-14-7-5-4-6-8-14/h4-8,15-16H,9-10,12-13H2,1-3H3,(H,20,22)/t15-,16+/m0/s1 |
| InChIKey | BFTGPOIQJWKWKB-JKSUJKDBSA-N |
| XLogP | 2.93 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |