C19H29FN2O2 — CID 20599298
tert-butyl N-[(3R,4R)-1-benzyl-4-(2-fluoroethyl)piperidin-3-yl]carbamate (PubChem CID 20599298) has the molecular formula C19H29FN2O2 and a molecular weight of 336.45 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-1-benzyl-4-(2-fluoroethyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-1-benzyl-4-(2-fluoroethyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 20599298 |
| Molecular Formula | C19H29FN2O2 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | tert-butyl N-[(3R,4R)-1-benzyl-4-(2-fluoroethyl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CN(Cc2ccccc2)CC[C@@H]1CCF |
| InChI | InChI=1S/C19H29FN2O2/c1-19(2,3)24-18(23)21-17-14-22(12-10-16(17)9-11-20)13-15-7-5-4-6-8-15/h4-8,16-17H,9-14H2,1-3H3,(H,21,23)/t16-,17-/m0/s1 |
| InChIKey | CGYZNMFPCVDOJZ-IRXDYDNUSA-N |
| XLogP | 3.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |