C34H42N2OSi — CID 145214103
[1-benzyl-4-[(4-quinolin-5-ylphenyl)methyl]piperidin-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 145214103) has the molecular formula C34H42N2OSi and a molecular weight of 522.81 g/mol. Its IUPAC name is [1-benzyl-4-[(4-quinolin-5-ylphenyl)methyl]piperidin-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [1-benzyl-4-[(4-quinolin-5-ylphenyl)methyl]piperidin-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 145214103 |
| Molecular Formula | C34H42N2OSi |
| Molecular Weight | 522.81 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | [1-benzyl-4-[(4-quinolin-5-ylphenyl)methyl]piperidin-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CN(Cc2ccccc2)CCC1Cc1ccc(-c2cccc3ncccc23)cc1 |
| InChI | InChI=1S/C34H42N2OSi/c1-34(2,3)38(4,5)37-33-25-36(24-27-11-7-6-8-12-27)22-20-29(33)23-26-16-18-28(19-17-26)30-13-9-15-32-31(30)14-10-21-35-32/h6-19,21,29,33H,20,22-25H2,1-5H3 |
| InChIKey | MLTDMAUEUSUTAJ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.81 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|