C26H34N2O5 — CID 90005030
[(2R,3R,4R,5S)-5-acetamido-1-benzyl-2-(butoxymethyl)-3-hydroxypiperidin-4-yl] benzoate (PubChem CID 90005030) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-5-acetamido-1-benzyl-2-(butoxymethyl)-3-hydroxypiperidin-4-yl] benzoate.
| Compound Name | [(2R,3R,4R,5S)-5-acetamido-1-benzyl-2-(butoxymethyl)-3-hydroxypiperidin-4-yl] benzoate |
|---|---|
| PubChem CID | 90005030 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | [(2R,3R,4R,5S)-5-acetamido-1-benzyl-2-(butoxymethyl)-3-hydroxypiperidin-4-yl] benzoate |
| SMILES | CCCCOC[C@@H]1[C@@H](O)[C@H](OC(=O)c2ccccc2)[C@@H](NC(C)=O)CN1Cc1ccccc1 |
| InChI | InChI=1S/C26H34N2O5/c1-3-4-15-32-18-23-24(30)25(33-26(31)21-13-9-6-10-14-21)22(27-19(2)29)17-28(23)16-20-11-7-5-8-12-20/h5-14,22-25,30H,3-4,15-18H2,1-2H3,(H,27,29)/t22-,23+,24+,25+/m0/s1 |
| InChIKey | FWCUQZVHDZKXRO-ZYQDXHPFSA-N |
| XLogP | 2.78 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|