C21H21N3O3 — CID 101052904
(1R,2S,5S,8S)-3-benzyl-10-methyl-5-phenyl-7-oxa-3,6,10-triazatricyclo[6.3.0.02,6]undecane-9,11-dione (PubChem CID 101052904) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is (1R,2S,5S,8S)-3-benzyl-10-methyl-5-phenyl-7-oxa-3,6,10-triazatricyclo[6.3.0.02,6]undecane-9,11-dione.
| Compound Name | (1R,2S,5S,8S)-3-benzyl-10-methyl-5-phenyl-7-oxa-3,6,10-triazatricyclo[6.3.0.02,6]undecane-9,11-dione |
|---|---|
| PubChem CID | 101052904 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (1R,2S,5S,8S)-3-benzyl-10-methyl-5-phenyl-7-oxa-3,6,10-triazatricyclo[6.3.0.02,6]undecane-9,11-dione |
| SMILES | CN1C(=O)[C@H]2[C@H](ON3[C@@H](c4ccccc4)CN(Cc4ccccc4)[C@H]23)C1=O |
| InChI | InChI=1S/C21H21N3O3/c1-22-20(25)17-18(21(22)26)27-24-16(15-10-6-3-7-11-15)13-23(19(17)24)12-14-8-4-2-5-9-14/h2-11,16-19H,12-13H2,1H3/t16-,17+,18+,19+/m1/s1 |
| InChIKey | LBACHOQDNSNKGB-XWSJACJDSA-N |
| XLogP | 1.80 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|