C26H26N2O — CID 15496859
(1S,4R,8aR)-2-benzyl-1,4-diphenyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 15496859) has the molecular formula C26H26N2O and a molecular weight of 382.51 g/mol. Its IUPAC name is (1S,4R,8aR)-2-benzyl-1,4-diphenyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | (1S,4R,8aR)-2-benzyl-1,4-diphenyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 15496859 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (1S,4R,8aR)-2-benzyl-1,4-diphenyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | O=C1CC[C@@H]2[C@H](c3ccccc3)N(Cc3ccccc3)C[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C26H26N2O/c29-25-17-16-23-26(22-14-8-3-9-15-22)27(18-20-10-4-1-5-11-20)19-24(28(23)25)21-12-6-2-7-13-21/h1-15,23-24,26H,16-19H2/t23-,24+,26+/m1/s1 |
| InChIKey | QFPOOERTAGBRSK-USZFVNFHSA-N |
| XLogP | 4.98 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |