C21H22N2O — CID 10980080
(6S,7R,11R)-10-benzyl-2,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),12,14-trien-3-one (PubChem CID 10980080) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is (6S,7R,11R)-10-benzyl-2,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),12,14-trien-3-one.
| Compound Name | (6S,7R,11R)-10-benzyl-2,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),12,14-trien-3-one |
|---|---|
| PubChem CID | 10980080 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (6S,7R,11R)-10-benzyl-2,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),12,14-trien-3-one |
| SMILES | O=C1CC[C@H]2[C@H]3CCN(Cc4ccccc4)[C@H]3c3ccccc3N12 |
| InChI | InChI=1S/C21H22N2O/c24-20-11-10-19-17-12-13-22(14-15-6-2-1-3-7-15)21(17)16-8-4-5-9-18(16)23(19)20/h1-9,17,19,21H,10-14H2/t17-,19+,21+/m1/s1 |
| InChIKey | MEKIJMPXBVGLSO-LMNJBCLMSA-N |
| XLogP | 3.76 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |