C21H22N2O3 — CID 134834955
(1S,5R)-2-benzyl-8-(2-nitrophenyl)-2-azabicyclo[3.3.1]nonan-7-one (PubChem CID 134834955) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (1S,5R)-2-benzyl-8-(2-nitrophenyl)-2-azabicyclo[3.3.1]nonan-7-one.
| Compound Name | (1S,5R)-2-benzyl-8-(2-nitrophenyl)-2-azabicyclo[3.3.1]nonan-7-one |
|---|---|
| PubChem CID | 134834955 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (1S,5R)-2-benzyl-8-(2-nitrophenyl)-2-azabicyclo[3.3.1]nonan-7-one |
| SMILES | O=C1C[C@@H]2CCN(Cc3ccccc3)[C@@H](C2)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22N2O3/c24-20-13-16-10-11-22(14-15-6-2-1-3-7-15)19(12-16)21(20)17-8-4-5-9-18(17)23(25)26/h1-9,16,19,21H,10-14H2/t16-,19+,21?/m1/s1 |
| InChIKey | FAPSMLQEZGNLPG-NTEFNCDNSA-N |
| XLogP | 3.93 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|