C23H25N3O2 — CID 50915435
methyl (3R,5R,7R,7aS)-1-benzyl-7-cyano-7-methyl-3-phenyl-3,5,6,7a-tetrahydro-2H-pyrrolo[1,2-a]imidazole-5-carboxylate (PubChem CID 50915435) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is methyl (3R,5R,7R,7aS)-1-benzyl-7-cyano-7-methyl-3-phenyl-3,5,6,7a-tetrahydro-2H-pyrrolo[1,2-a]imidazole-5-carboxylate.
| Compound Name | methyl (3R,5R,7R,7aS)-1-benzyl-7-cyano-7-methyl-3-phenyl-3,5,6,7a-tetrahydro-2H-pyrrolo[1,2-a]imidazole-5-carboxylate |
|---|---|
| PubChem CID | 50915435 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | methyl (3R,5R,7R,7aS)-1-benzyl-7-cyano-7-methyl-3-phenyl-3,5,6,7a-tetrahydro-2H-pyrrolo[1,2-a]imidazole-5-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@](C)(C#N)[C@H]2N(Cc3ccccc3)C[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C23H25N3O2/c1-23(16-24)13-19(21(27)28-2)26-20(18-11-7-4-8-12-18)15-25(22(23)26)14-17-9-5-3-6-10-17/h3-12,19-20,22H,13-15H2,1-2H3/t19-,20+,22+,23+/m1/s1 |
| InChIKey | KPJZNFWIGCDIFP-VAPSRWTKSA-N |
| XLogP | 3.35 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |