C27H28N2O4S — CID 101495169
methyl (3R,5R,7S,7aR)-7-(benzenesulfonyl)-1-benzyl-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-a]imidazole-5-carboxylate (PubChem CID 101495169) has the molecular formula C27H28N2O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is methyl (3R,5R,7S,7aR)-7-(benzenesulfonyl)-1-benzyl-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-a]imidazole-5-carboxylate.
| Compound Name | methyl (3R,5R,7S,7aR)-7-(benzenesulfonyl)-1-benzyl-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-a]imidazole-5-carboxylate |
|---|---|
| PubChem CID | 101495169 |
| Molecular Formula | C27H28N2O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | methyl (3R,5R,7S,7aR)-7-(benzenesulfonyl)-1-benzyl-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-a]imidazole-5-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H](S(=O)(=O)c2ccccc2)[C@@H]2N(Cc3ccccc3)C[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C27H28N2O4S/c1-33-27(30)23-17-25(34(31,32)22-15-9-4-10-16-22)26-28(18-20-11-5-2-6-12-20)19-24(29(23)26)21-13-7-3-8-14-21/h2-16,23-26H,17-19H2,1H3/t23-,24+,25+,26-/m1/s1 |
| InChIKey | XJDGINPQHWEDAC-KEVKATSASA-N |
| XLogP | 3.66 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |