C19H21NO3S — CID 135050189
1-[(3S,4S)-4-(benzenesulfonyl)-1-benzylpyrrolidin-3-yl]ethanone (PubChem CID 135050189) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-[(3S,4S)-4-(benzenesulfonyl)-1-benzylpyrrolidin-3-yl]ethanone.
| Compound Name | 1-[(3S,4S)-4-(benzenesulfonyl)-1-benzylpyrrolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 135050189 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-[(3S,4S)-4-(benzenesulfonyl)-1-benzylpyrrolidin-3-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CN(Cc2ccccc2)C[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H21NO3S/c1-15(21)18-13-20(12-16-8-4-2-5-9-16)14-19(18)24(22,23)17-10-6-3-7-11-17/h2-11,18-19H,12-14H2,1H3/t18-,19+/m0/s1 |
| InChIKey | WIIMQFGYPOIXMJ-RBUKOAKNSA-N |
| XLogP | 2.55 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |