C24H30N2O4S — CID 110224109
(3S,4S)-4-(benzenesulfonyl)-1-benzyl-N-(oxan-3-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 110224109) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is (3S,4S)-4-(benzenesulfonyl)-1-benzyl-N-(oxan-3-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-4-(benzenesulfonyl)-1-benzyl-N-(oxan-3-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 110224109 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (3S,4S)-4-(benzenesulfonyl)-1-benzyl-N-(oxan-3-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCC1CCCOC1)[C@@H]1CN(Cc2ccccc2)C[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H30N2O4S/c27-24(25-14-20-10-7-13-30-18-20)22-16-26(15-19-8-3-1-4-9-19)17-23(22)31(28,29)21-11-5-2-6-12-21/h1-6,8-9,11-12,20,22-23H,7,10,13-18H2,(H,25,27)/t20?,22-,23-/m1/s1 |
| InChIKey | KPXFVUGANPNLMH-JHRSTNGLSA-N |
| XLogP | 2.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |