C15H25NO4 — CID 114511623
4-ethyl-2-(oxan-3-ylmethylcarbamoyl)cyclopentane-1-carboxylic acid (PubChem CID 114511623) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-ethyl-2-(oxan-3-ylmethylcarbamoyl)cyclopentane-1-carboxylic acid.
| Compound Name | 4-ethyl-2-(oxan-3-ylmethylcarbamoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114511623 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 4-ethyl-2-(oxan-3-ylmethylcarbamoyl)cyclopentane-1-carboxylic acid |
| SMILES | CCC1CC(C(=O)O)C(C(=O)NCC2CCCOC2)C1 |
| InChI | InChI=1S/C15H25NO4/c1-2-10-6-12(13(7-10)15(18)19)14(17)16-8-11-4-3-5-20-9-11/h10-13H,2-9H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | ZEBMWIZHUHNNOF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |