C17H29NO3 — CID 106003697
cis-(1R,2S)-2-(3-cyclopentylpropylcarbamoyl)-4-ethylcyclopentane-1-carboxylic acid (PubChem CID 106003697) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is cis-(1R,2S)-2-(3-cyclopentylpropylcarbamoyl)-4-ethylcyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-(3-cyclopentylpropylcarbamoyl)-4-ethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106003697 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | cis-(1R,2S)-2-(3-cyclopentylpropylcarbamoyl)-4-ethylcyclopentane-1-carboxylic acid |
| SMILES | CCC1C[C@H](C(=O)NCCCC2CCCC2)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C17H29NO3/c1-2-12-10-14(15(11-12)17(20)21)16(19)18-9-5-8-13-6-3-4-7-13/h12-15H,2-11H2,1H3,(H,18,19)(H,20,21)/t12?,14-,15+/m0/s1 |
| InChIKey | GEJPOEINTRDCJK-JQXSQYPDSA-N |
| XLogP | 3.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|