C14H25NO4 — CID 106120354
cis-(1R,2S)-4-ethyl-2-(4-hydroxypentylcarbamoyl)cyclopentane-1-carboxylic acid (PubChem CID 106120354) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is cis-(1R,2S)-4-ethyl-2-(4-hydroxypentylcarbamoyl)cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-4-ethyl-2-(4-hydroxypentylcarbamoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106120354 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | cis-(1R,2S)-4-ethyl-2-(4-hydroxypentylcarbamoyl)cyclopentane-1-carboxylic acid |
| SMILES | CCC1C[C@H](C(=O)NCCCC(C)O)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C14H25NO4/c1-3-10-7-11(12(8-10)14(18)19)13(17)15-6-4-5-9(2)16/h9-12,16H,3-8H2,1-2H3,(H,15,17)(H,18,19)/t9?,10?,11-,12+/m0/s1 |
| InChIKey | CDBGSBDHWNEJPO-MMVSWEMESA-N |
| XLogP | 1.40 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|