C12H17F4NO3 — CID 106290416
cis-(1R,2S)-4-ethyl-2-(2,2,3,3-tetrafluoropropylcarbamoyl)cyclopentane-1-carboxylic acid (PubChem CID 106290416) has the molecular formula C12H17F4NO3 and a molecular weight of 299.26 g/mol. Its IUPAC name is cis-(1R,2S)-4-ethyl-2-(2,2,3,3-tetrafluoropropylcarbamoyl)cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-4-ethyl-2-(2,2,3,3-tetrafluoropropylcarbamoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106290416 |
| Molecular Formula | C12H17F4NO3 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | cis-(1R,2S)-4-ethyl-2-(2,2,3,3-tetrafluoropropylcarbamoyl)cyclopentane-1-carboxylic acid |
| SMILES | CCC1C[C@H](C(=O)NCC(F)(F)C(F)F)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C12H17F4NO3/c1-2-6-3-7(8(4-6)10(19)20)9(18)17-5-12(15,16)11(13)14/h6-8,11H,2-5H2,1H3,(H,17,18)(H,19,20)/t6?,7-,8+/m0/s1 |
| InChIKey | WHTSSTJEQAEFHU-ZHFSPANRSA-N |
| XLogP | 2.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|