C25H29FN2O3 — CID 46968030
(3S,4S)-1-benzyl-4-(4-fluorobenzoyl)-N-(oxan-3-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 46968030) has the molecular formula C25H29FN2O3 and a molecular weight of 424.52 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-4-(4-fluorobenzoyl)-N-(oxan-3-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-1-benzyl-4-(4-fluorobenzoyl)-N-(oxan-3-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46968030 |
| Molecular Formula | C25H29FN2O3 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (3S,4S)-1-benzyl-4-(4-fluorobenzoyl)-N-(oxan-3-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCC1CCCOC1)[C@@H]1CN(Cc2ccccc2)C[C@H]1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H29FN2O3/c26-21-10-8-20(9-11-21)24(29)22-15-28(14-18-5-2-1-3-6-18)16-23(22)25(30)27-13-19-7-4-12-31-17-19/h1-3,5-6,8-11,19,22-23H,4,7,12-17H2,(H,27,30)/t19?,22-,23-/m1/s1 |
| InChIKey | RPXAZOUXKVXVAR-QENMJEOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |