C26H33NO2 — CID 131862864
1-[(2S,4R)-2-benzoyl-4-phenylpiperidin-1-yl]-2,2-diethylbutan-1-one (PubChem CID 131862864) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-[(2S,4R)-2-benzoyl-4-phenylpiperidin-1-yl]-2,2-diethylbutan-1-one.
| Compound Name | 1-[(2S,4R)-2-benzoyl-4-phenylpiperidin-1-yl]-2,2-diethylbutan-1-one |
|---|---|
| PubChem CID | 131862864 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 1-[(2S,4R)-2-benzoyl-4-phenylpiperidin-1-yl]-2,2-diethylbutan-1-one |
| SMILES | CCC(CC)(CC)C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H33NO2/c1-4-26(5-2,6-3)25(29)27-18-17-22(20-13-9-7-10-14-20)19-23(27)24(28)21-15-11-8-12-16-21/h7-16,22-23H,4-6,17-19H2,1-3H3/t22-,23+/m1/s1 |
| InChIKey | FDMJCHPLPGJHOX-PKTZIBPZSA-N |
| XLogP | 5.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |