C25H30N2O7 — CID 14230559
butyl 1-[(2,4-dimethoxyphenyl)methyl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidine-2-carboxylate (PubChem CID 14230559) has the molecular formula C25H30N2O7 and a molecular weight of 470.52 g/mol. Its IUPAC name is butyl 1-[(2,4-dimethoxyphenyl)methyl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidine-2-carboxylate.
| Compound Name | butyl 1-[(2,4-dimethoxyphenyl)methyl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 14230559 |
| Molecular Formula | C25H30N2O7 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | butyl 1-[(2,4-dimethoxyphenyl)methyl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidine-2-carboxylate |
| SMILES | CCCCOC(=O)C1C(NC(=O)OCc2ccccc2)C(=O)N1Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C25H30N2O7/c1-4-5-13-33-24(29)22-21(26-25(30)34-16-17-9-7-6-8-10-17)23(28)27(22)15-18-11-12-19(31-2)14-20(18)32-3/h6-12,14,21-22H,4-5,13,15-16H2,1-3H3,(H,26,30) |
| InChIKey | HOEAMZGADGQBDD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|