C22H24N2O8 — CID 18644494
[(2R,3R)-1-[(2,4-dimethoxyphenyl)methyl]-2-methoxycarbonyl-4-oxoazetidin-3-yl]-phenylmethoxycarbamic acid (PubChem CID 18644494) has the molecular formula C22H24N2O8 and a molecular weight of 444.44 g/mol. Its IUPAC name is [(2R,3R)-1-[(2,4-dimethoxyphenyl)methyl]-2-methoxycarbonyl-4-oxoazetidin-3-yl]-phenylmethoxycarbamic acid.
| Compound Name | [(2R,3R)-1-[(2,4-dimethoxyphenyl)methyl]-2-methoxycarbonyl-4-oxoazetidin-3-yl]-phenylmethoxycarbamic acid |
|---|---|
| PubChem CID | 18644494 |
| Molecular Formula | C22H24N2O8 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [(2R,3R)-1-[(2,4-dimethoxyphenyl)methyl]-2-methoxycarbonyl-4-oxoazetidin-3-yl]-phenylmethoxycarbamic acid |
| SMILES | COC(=O)[C@H]1[C@@H](N(OCc2ccccc2)C(=O)O)C(=O)N1Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C22H24N2O8/c1-29-16-10-9-15(17(11-16)30-2)12-23-19(21(26)31-3)18(20(23)25)24(22(27)28)32-13-14-7-5-4-6-8-14/h4-11,18-19H,12-13H2,1-3H3,(H,27,28)/t18-,19-/m1/s1 |
| InChIKey | QRMCBPGQMUNLHK-RTBURBONSA-N |
| XLogP | 2.07 |
| TPSA | 114.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|