C21H24N5O5+ — CID 118379450
[(2R,3S)-3-[benzyl(carboxy)amino]-1-[(2,4-dimethoxyphenyl)methyl]-4-oxoazetidin-2-yl]methylimino-iminoazanium (PubChem CID 118379450) has the molecular formula C21H24N5O5+ and a molecular weight of 426.45 g/mol. Its IUPAC name is [(2R,3S)-3-[benzyl(carboxy)amino]-1-[(2,4-dimethoxyphenyl)methyl]-4-oxoazetidin-2-yl]methylimino-iminoazanium.
| Compound Name | [(2R,3S)-3-[benzyl(carboxy)amino]-1-[(2,4-dimethoxyphenyl)methyl]-4-oxoazetidin-2-yl]methylimino-iminoazanium |
|---|---|
| PubChem CID | 118379450 |
| Molecular Formula | C21H24N5O5+ |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [(2R,3S)-3-[benzyl(carboxy)amino]-1-[(2,4-dimethoxyphenyl)methyl]-4-oxoazetidin-2-yl]methylimino-iminoazanium |
| SMILES | COc1ccc(CN2C(=O)[C@@H](N(Cc3ccccc3)C(=O)O)[C@H]2CN=[N+]=N)c(OC)c1 |
| InChI | InChI=1S/C21H23N5O5/c1-30-16-9-8-15(18(10-16)31-2)13-25-17(11-23-24-22)19(20(25)27)26(21(28)29)12-14-6-4-3-5-7-14/h3-10,17,19,22H,11-13H2,1-2H3/p+1/t17-,19+/m1/s1 |
| InChIKey | ZDCFZNFRRQMABQ-MJGOQNOKSA-O |
| XLogP | 2.51 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|