C22H25NO3 — CID 11602763
(2S,5R)-2-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2,5-dihydropyridin-6-one (PubChem CID 11602763) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (2S,5R)-2-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2,5-dihydropyridin-6-one.
| Compound Name | (2S,5R)-2-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2,5-dihydropyridin-6-one |
|---|---|
| PubChem CID | 11602763 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (2S,5R)-2-benzyl-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2,5-dihydropyridin-6-one |
| SMILES | COc1ccc(CN2C(=O)[C@H](C)C=C[C@@H]2Cc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C22H25NO3/c1-16-9-11-19(13-17-7-5-4-6-8-17)23(22(16)24)15-18-10-12-20(25-2)14-21(18)26-3/h4-12,14,16,19H,13,15H2,1-3H3/t16-,19-/m1/s1 |
| InChIKey | MDVSSWKUHSCQKE-VQIMIIECSA-N |
| XLogP | 3.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|