C29H27N3O7 — CID 118379364
benzyl-[(2S,3S)-1-[(2,4-dimethoxyphenyl)methyl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxoazetidin-3-yl]carbamic acid (PubChem CID 118379364) has the molecular formula C29H27N3O7 and a molecular weight of 529.55 g/mol. Its IUPAC name is benzyl-[(2S,3S)-1-[(2,4-dimethoxyphenyl)methyl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxoazetidin-3-yl]carbamic acid.
| Compound Name | benzyl-[(2S,3S)-1-[(2,4-dimethoxyphenyl)methyl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxoazetidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 118379364 |
| Molecular Formula | C29H27N3O7 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | benzyl-[(2S,3S)-1-[(2,4-dimethoxyphenyl)methyl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxoazetidin-3-yl]carbamic acid |
| SMILES | COc1ccc(CN2C(=O)[C@@H](N(Cc3ccccc3)C(=O)O)[C@@H]2CN2C(=O)c3ccccc3C2=O)c(OC)c1 |
| InChI | InChI=1S/C29H27N3O7/c1-38-20-13-12-19(24(14-20)39-2)16-30-23(17-32-26(33)21-10-6-7-11-22(21)27(32)34)25(28(30)35)31(29(36)37)15-18-8-4-3-5-9-18/h3-14,23,25H,15-17H2,1-2H3,(H,36,37)/t23-,25-/m0/s1 |
| InChIKey | CIDPITKODPAAKX-ZCYQVOJMSA-N |
| XLogP | 3.26 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|