C22H21N3O7 — CID 118393729
[(2S,3S)-1-[(2,4-dimethoxyphenyl)methyl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxoazetidin-3-yl]carbamic acid (PubChem CID 118393729) has the molecular formula C22H21N3O7 and a molecular weight of 439.42 g/mol. Its IUPAC name is [(2S,3S)-1-[(2,4-dimethoxyphenyl)methyl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxoazetidin-3-yl]carbamic acid.
| Compound Name | [(2S,3S)-1-[(2,4-dimethoxyphenyl)methyl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxoazetidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 118393729 |
| Molecular Formula | C22H21N3O7 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | [(2S,3S)-1-[(2,4-dimethoxyphenyl)methyl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxoazetidin-3-yl]carbamic acid |
| SMILES | COc1ccc(CN2C(=O)[C@@H](NC(=O)O)[C@@H]2CN2C(=O)c3ccccc3C2=O)c(OC)c1 |
| InChI | InChI=1S/C22H21N3O7/c1-31-13-8-7-12(17(9-13)32-2)10-24-16(18(21(24)28)23-22(29)30)11-25-19(26)14-5-3-4-6-15(14)20(25)27/h3-9,16,18,23H,10-11H2,1-2H3,(H,29,30)/t16-,18-/m0/s1 |
| InChIKey | AAQIABMWISNSIE-WMZOPIPTSA-N |
| XLogP | 1.35 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|