C24H26N2O7 — CID 70343710
methyl (Z)-3-[1-[(2,4-dimethoxyphenyl)methyl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]prop-2-enoate (PubChem CID 70343710) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is methyl (Z)-3-[1-[(2,4-dimethoxyphenyl)methyl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]prop-2-enoate.
| Compound Name | methyl (Z)-3-[1-[(2,4-dimethoxyphenyl)methyl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 70343710 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | methyl (Z)-3-[1-[(2,4-dimethoxyphenyl)methyl]-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C\C1C(NC(=O)OCc2ccccc2)C(=O)N1Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C24H26N2O7/c1-30-18-10-9-17(20(13-18)31-2)14-26-19(11-12-21(27)32-3)22(23(26)28)25-24(29)33-15-16-7-5-4-6-8-16/h4-13,19,22H,14-15H2,1-3H3,(H,25,29)/b12-11- |
| InChIKey | IBDAYBLYLWOMLS-QXMHVHEDSA-N |
| XLogP | 2.44 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|