C21H29N3O3 — CID 10292630
N-tert-butyl-7-methoxy-12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-triene-17-carboxamide (PubChem CID 10292630) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-tert-butyl-7-methoxy-12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-triene-17-carboxamide.
| Compound Name | N-tert-butyl-7-methoxy-12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-triene-17-carboxamide |
|---|---|
| PubChem CID | 10292630 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-tert-butyl-7-methoxy-12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-triene-17-carboxamide |
| SMILES | COc1cccc2c1CCN1C(=O)C3CCCC(C21)N3C(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H29N3O3/c1-21(2,3)22-20(26)24-15-8-6-9-16(24)19(25)23-12-11-13-14(18(15)23)7-5-10-17(13)27-4/h5,7,10,15-16,18H,6,8-9,11-12H2,1-4H3,(H,22,26) |
| InChIKey | MBJDIFHLOYHCPG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |