C24H25F2N3O3 — CID 142184723
N-(2,4-difluorophenyl)-6-methoxy-17-methyl-11-oxo-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-triene-15-carboxamide (PubChem CID 142184723) has the molecular formula C24H25F2N3O3 and a molecular weight of 441.48 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-6-methoxy-17-methyl-11-oxo-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-triene-15-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-6-methoxy-17-methyl-11-oxo-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-triene-15-carboxamide |
|---|---|
| PubChem CID | 142184723 |
| Molecular Formula | C24H25F2N3O3 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-(2,4-difluorophenyl)-6-methoxy-17-methyl-11-oxo-10,16-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-triene-15-carboxamide |
| SMILES | COc1cccc2c1CCN1C(=O)C3CCC(C(=O)Nc4ccc(F)cc4F)N3C(C)C21 |
| InChI | InChI=1S/C24H25F2N3O3/c1-13-22-16-4-3-5-21(32-2)15(16)10-11-28(22)24(31)20-9-8-19(29(13)20)23(30)27-18-7-6-14(25)12-17(18)26/h3-7,12-13,19-20,22H,8-11H2,1-2H3,(H,27,30) |
| InChIKey | JUWHSISLAHPUBD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |