C19H18F2N2O2 — CID 92991057
(3R)-N-(2,4-difluorophenyl)-1-(2,3-dimethylphenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 92991057) has the molecular formula C19H18F2N2O2 and a molecular weight of 344.36 g/mol. Its IUPAC name is (3R)-N-(2,4-difluorophenyl)-1-(2,3-dimethylphenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(2,4-difluorophenyl)-1-(2,3-dimethylphenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 92991057 |
| Molecular Formula | C19H18F2N2O2 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (3R)-N-(2,4-difluorophenyl)-1-(2,3-dimethylphenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1cccc(N2CC[C@H](C(=O)Nc3ccc(F)cc3F)C2=O)c1C |
| InChI | InChI=1S/C19H18F2N2O2/c1-11-4-3-5-17(12(11)2)23-9-8-14(19(23)25)18(24)22-16-7-6-13(20)10-15(16)21/h3-7,10,14H,8-9H2,1-2H3,(H,22,24)/t14-/m1/s1 |
| InChIKey | BDVQMZMZZOEUJL-CQSZACIVSA-N |
| XLogP | 3.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|