C19H19FN2O3 — CID 93331069
(3R)-1-(3-fluoro-2-methylphenyl)-N-(4-methoxyphenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 93331069) has the molecular formula C19H19FN2O3 and a molecular weight of 342.37 g/mol. Its IUPAC name is (3R)-1-(3-fluoro-2-methylphenyl)-N-(4-methoxyphenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(3-fluoro-2-methylphenyl)-N-(4-methoxyphenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93331069 |
| Molecular Formula | C19H19FN2O3 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (3R)-1-(3-fluoro-2-methylphenyl)-N-(4-methoxyphenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@H]2CCN(c3cccc(F)c3C)C2=O)cc1 |
| InChI | InChI=1S/C19H19FN2O3/c1-12-16(20)4-3-5-17(12)22-11-10-15(19(22)24)18(23)21-13-6-8-14(25-2)9-7-13/h3-9,15H,10-11H2,1-2H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | LIUCMKSGLLBZSS-OAHLLOKOSA-N |
| XLogP | 3.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|