C20H21FN2O4 — CID 46048576
1-(2,5-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 46048576) has the molecular formula C20H21FN2O4 and a molecular weight of 372.40 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46048576 |
| Molecular Formula | C20H21FN2O4 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(OC)c(N2CCC(C(=O)NCc3ccc(F)cc3)C2=O)c1 |
| InChI | InChI=1S/C20H21FN2O4/c1-26-15-7-8-18(27-2)17(11-15)23-10-9-16(20(23)25)19(24)22-12-13-3-5-14(21)6-4-13/h3-8,11,16H,9-10,12H2,1-2H3,(H,22,24) |
| InChIKey | WRTZKQUTPHTKIU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|