C22H25FN2O3 — CID 94080020
(3R)-N-[(4-butoxyphenyl)methyl]-1-(4-fluorophenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 94080020) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is (3R)-N-[(4-butoxyphenyl)methyl]-1-(4-fluorophenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[(4-butoxyphenyl)methyl]-1-(4-fluorophenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 94080020 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (3R)-N-[(4-butoxyphenyl)methyl]-1-(4-fluorophenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | CCCCOc1ccc(CNC(=O)[C@H]2CCN(c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H25FN2O3/c1-2-3-14-28-19-10-4-16(5-11-19)15-24-21(26)20-12-13-25(22(20)27)18-8-6-17(23)7-9-18/h4-11,20H,2-3,12-15H2,1H3,(H,24,26)/t20-/m1/s1 |
| InChIKey | NRONUPZAQYATFJ-HXUWFJFHSA-N |
| XLogP | 3.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|