C21H23FN2O4 — CID 50797727
N-[(3-ethoxy-4-methoxyphenyl)methyl]-1-(4-fluorophenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 50797727) has the molecular formula C21H23FN2O4 and a molecular weight of 386.42 g/mol. Its IUPAC name is N-[(3-ethoxy-4-methoxyphenyl)methyl]-1-(4-fluorophenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[(3-ethoxy-4-methoxyphenyl)methyl]-1-(4-fluorophenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 50797727 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-[(3-ethoxy-4-methoxyphenyl)methyl]-1-(4-fluorophenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | CCOc1cc(CNC(=O)C2CCN(c3ccc(F)cc3)C2=O)ccc1OC |
| InChI | InChI=1S/C21H23FN2O4/c1-3-28-19-12-14(4-9-18(19)27-2)13-23-20(25)17-10-11-24(21(17)26)16-7-5-15(22)6-8-16/h4-9,12,17H,3,10-11,13H2,1-2H3,(H,23,25) |
| InChIKey | JDVJVLWJCVQPTQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|