C27H35N3O7 — CID 160938992
4-cyclopentyl-13-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridec-2-ene-5,8-dione;methane (PubChem CID 160938992) has the molecular formula C27H35N3O7 and a molecular weight of 513.59 g/mol. Its IUPAC name is 4-cyclopentyl-13-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridec-2-ene-5,8-dione;methane.
| Compound Name | 4-cyclopentyl-13-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridec-2-ene-5,8-dione;methane |
|---|---|
| PubChem CID | 160938992 |
| Molecular Formula | C27H35N3O7 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | 4-cyclopentyl-13-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridec-2-ene-5,8-dione;methane |
| SMILES | C.COc1cc(C(=O)C(=O)N2C3CCCC2C2=CN(C4CCCC4)C(=O)CN2C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C26H31N3O7.CH4/c1-34-20-11-15(12-21(35-2)24(20)36-3)23(31)26(33)29-17-9-6-10-18(29)25(32)28-14-22(30)27(13-19(17)28)16-7-4-5-8-16;/h11-13,16-18H,4-10,14H2,1-3H3;1H4 |
| InChIKey | SUGGEJVUJXIEQK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|