C28H24F6N2O6 — CID 21363717
1-[12-oxo-6,8-bis(trifluoromethyl)-11,17-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7-tetraen-17-yl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione (PubChem CID 21363717) has the molecular formula C28H24F6N2O6 and a molecular weight of 598.50 g/mol. Its IUPAC name is 1-[12-oxo-6,8-bis(trifluoromethyl)-11,17-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7-tetraen-17-yl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-[12-oxo-6,8-bis(trifluoromethyl)-11,17-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7-tetraen-17-yl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 21363717 |
| Molecular Formula | C28H24F6N2O6 |
| Molecular Weight | 598.50 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | 1-[12-oxo-6,8-bis(trifluoromethyl)-11,17-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7-tetraen-17-yl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione |
| SMILES | COc1cc(C(=O)C(=O)N2C3CCCC2C2=Cc4cc(C(F)(F)F)cc(C(F)(F)F)c4CN2C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C28H24F6N2O6/c1-40-21-9-14(10-22(41-2)24(21)42-3)23(37)26(39)36-18-5-4-6-19(36)25(38)35-12-16-13(8-20(18)35)7-15(27(29,30)31)11-17(16)28(32,33)34/h7-11,18-19H,4-6,12H2,1-3H3 |
| InChIKey | LIAQDOYSHCHLDC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|