C29H26F6N2O6 — CID 21363709
3-[12-oxo-6,8-bis(trifluoromethyl)-11,17-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7-tetraen-17-yl]-1-(3,4,5-trimethoxyphenyl)propane-1,2-dione (PubChem CID 21363709) has the molecular formula C29H26F6N2O6 and a molecular weight of 612.52 g/mol. Its IUPAC name is 3-[12-oxo-6,8-bis(trifluoromethyl)-11,17-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7-tetraen-17-yl]-1-(3,4,5-trimethoxyphenyl)propane-1,2-dione.
| Compound Name | 3-[12-oxo-6,8-bis(trifluoromethyl)-11,17-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7-tetraen-17-yl]-1-(3,4,5-trimethoxyphenyl)propane-1,2-dione |
|---|---|
| PubChem CID | 21363709 |
| Molecular Formula | C29H26F6N2O6 |
| Molecular Weight | 612.52 g/mol |
| Exact Mass | 612.17 |
| IUPAC Name | 3-[12-oxo-6,8-bis(trifluoromethyl)-11,17-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7-tetraen-17-yl]-1-(3,4,5-trimethoxyphenyl)propane-1,2-dione |
| SMILES | COc1cc(C(=O)C(=O)CN2C3CCCC2C2=Cc4cc(C(F)(F)F)cc(C(F)(F)F)c4CN2C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C29H26F6N2O6/c1-41-23-9-15(10-24(42-2)26(23)43-3)25(39)22(38)13-36-19-5-4-6-20(36)27(40)37-12-17-14(8-21(19)37)7-16(28(30,31)32)11-18(17)29(33,34)35/h7-11,19-20H,4-6,12-13H2,1-3H3 |
| InChIKey | TULAJVUPDYLFDD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|