C17H22N2O5 — CID 110720744
1-cyclopropyl-4-(3,4,5-trimethoxybenzoyl)piperazin-2-one (PubChem CID 110720744) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 1-cyclopropyl-4-(3,4,5-trimethoxybenzoyl)piperazin-2-one.
| Compound Name | 1-cyclopropyl-4-(3,4,5-trimethoxybenzoyl)piperazin-2-one |
|---|---|
| PubChem CID | 110720744 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-cyclopropyl-4-(3,4,5-trimethoxybenzoyl)piperazin-2-one |
| SMILES | COc1cc(C(=O)N2CCN(C3CC3)C(=O)C2)cc(OC)c1OC |
| InChI | InChI=1S/C17H22N2O5/c1-22-13-8-11(9-14(23-2)16(13)24-3)17(21)18-6-7-19(12-4-5-12)15(20)10-18/h8-9,12H,4-7,10H2,1-3H3 |
| InChIKey | AAYFJWSOHCAAGJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |