C26H30Cl2N2O6S — CID 73052730
(1S,5S,6S)-10-(3,5-dichlorophenyl)sulfonyl-3-[2-(3,4-dimethoxyphenoxy)ethyl]-5-ethenyl-3,10-diazabicyclo[4.3.1]decan-2-one (PubChem CID 73052730) has the molecular formula C26H30Cl2N2O6S and a molecular weight of 569.51 g/mol. Its IUPAC name is (1S,5S,6S)-10-(3,5-dichlorophenyl)sulfonyl-3-[2-(3,4-dimethoxyphenoxy)ethyl]-5-ethenyl-3,10-diazabicyclo[4.3.1]decan-2-one.
| Compound Name | (1S,5S,6S)-10-(3,5-dichlorophenyl)sulfonyl-3-[2-(3,4-dimethoxyphenoxy)ethyl]-5-ethenyl-3,10-diazabicyclo[4.3.1]decan-2-one |
|---|---|
| PubChem CID | 73052730 |
| Molecular Formula | C26H30Cl2N2O6S |
| Molecular Weight | 569.51 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | (1S,5S,6S)-10-(3,5-dichlorophenyl)sulfonyl-3-[2-(3,4-dimethoxyphenoxy)ethyl]-5-ethenyl-3,10-diazabicyclo[4.3.1]decan-2-one |
| SMILES | C=C[C@H]1CN(CCOc2ccc(OC)c(OC)c2)C(=O)[C@@H]2CCC[C@@H]1N2S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C26H30Cl2N2O6S/c1-4-17-16-29(10-11-36-20-8-9-24(34-2)25(15-20)35-3)26(31)23-7-5-6-22(17)30(23)37(32,33)21-13-18(27)12-19(28)14-21/h4,8-9,12-15,17,22-23H,1,5-7,10-11,16H2,2-3H3/t17-,22-,23-/m0/s1 |
| InChIKey | QCGNDXBPOLEVNS-RTFZILSDSA-N |
| XLogP | 4.65 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|