C22H23Cl2N3O4S — CID 118257718
(1S,5R,6R)-10-(3,5-dichloro-4-hydroxyphenyl)sulfonyl-5-ethenyl-3-(pyridin-2-ylmethyl)-3,10-diazabicyclo[4.3.1]decan-2-one (PubChem CID 118257718) has the molecular formula C22H23Cl2N3O4S and a molecular weight of 496.42 g/mol. Its IUPAC name is (1S,5R,6R)-10-(3,5-dichloro-4-hydroxyphenyl)sulfonyl-5-ethenyl-3-(pyridin-2-ylmethyl)-3,10-diazabicyclo[4.3.1]decan-2-one.
| Compound Name | (1S,5R,6R)-10-(3,5-dichloro-4-hydroxyphenyl)sulfonyl-5-ethenyl-3-(pyridin-2-ylmethyl)-3,10-diazabicyclo[4.3.1]decan-2-one |
|---|---|
| PubChem CID | 118257718 |
| Molecular Formula | C22H23Cl2N3O4S |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | (1S,5R,6R)-10-(3,5-dichloro-4-hydroxyphenyl)sulfonyl-5-ethenyl-3-(pyridin-2-ylmethyl)-3,10-diazabicyclo[4.3.1]decan-2-one |
| SMILES | C=C[C@@H]1CN(Cc2ccccn2)C(=O)[C@@H]2CCC[C@H]1N2S(=O)(=O)c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C22H23Cl2N3O4S/c1-2-14-12-26(13-15-6-3-4-9-25-15)22(29)20-8-5-7-19(14)27(20)32(30,31)16-10-17(23)21(28)18(24)11-16/h2-4,6,9-11,14,19-20,28H,1,5,7-8,12-13H2/t14-,19-,20+/m1/s1 |
| InChIKey | QAZMGZBJZMVXJT-XMCHAPAWSA-N |
| XLogP | 3.85 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|