C24H26N4O3S2 — CID 166721556
(1S,5S,6R)-10-(1,3-benzothiazol-6-ylsulfonyl)-5-ethenyl-3-(2-pyridin-2-ylethyl)-3,10-diazabicyclo[4.3.1]decan-2-one (PubChem CID 166721556) has the molecular formula C24H26N4O3S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is (1S,5S,6R)-10-(1,3-benzothiazol-6-ylsulfonyl)-5-ethenyl-3-(2-pyridin-2-ylethyl)-3,10-diazabicyclo[4.3.1]decan-2-one.
| Compound Name | (1S,5S,6R)-10-(1,3-benzothiazol-6-ylsulfonyl)-5-ethenyl-3-(2-pyridin-2-ylethyl)-3,10-diazabicyclo[4.3.1]decan-2-one |
|---|---|
| PubChem CID | 166721556 |
| Molecular Formula | C24H26N4O3S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | (1S,5S,6R)-10-(1,3-benzothiazol-6-ylsulfonyl)-5-ethenyl-3-(2-pyridin-2-ylethyl)-3,10-diazabicyclo[4.3.1]decan-2-one |
| SMILES | C=C[C@H]1CN(CCc2ccccn2)C(=O)[C@@H]2CCC[C@H]1N2S(=O)(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C24H26N4O3S2/c1-2-17-15-27(13-11-18-6-3-4-12-25-18)24(29)22-8-5-7-21(17)28(22)33(30,31)19-9-10-20-23(14-19)32-16-26-20/h2-4,6,9-10,12,14,16-17,21-22H,1,5,7-8,11,13,15H2/t17-,21+,22-/m0/s1 |
| InChIKey | SOTOITFRRPTLLA-WTOYTKOKSA-N |
| XLogP | 3.49 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|