C21H24N4O3S — CID 118257723
(1S,5R,6R)-5-ethenyl-3-(pyridin-2-ylmethyl)-10-pyridin-2-ylsulfonyl-3,10-diazabicyclo[4.3.1]decan-2-one (PubChem CID 118257723) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is (1S,5R,6R)-5-ethenyl-3-(pyridin-2-ylmethyl)-10-pyridin-2-ylsulfonyl-3,10-diazabicyclo[4.3.1]decan-2-one.
| Compound Name | (1S,5R,6R)-5-ethenyl-3-(pyridin-2-ylmethyl)-10-pyridin-2-ylsulfonyl-3,10-diazabicyclo[4.3.1]decan-2-one |
|---|---|
| PubChem CID | 118257723 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (1S,5R,6R)-5-ethenyl-3-(pyridin-2-ylmethyl)-10-pyridin-2-ylsulfonyl-3,10-diazabicyclo[4.3.1]decan-2-one |
| SMILES | C=C[C@@H]1CN(Cc2ccccn2)C(=O)[C@@H]2CCC[C@H]1N2S(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C21H24N4O3S/c1-2-16-14-24(15-17-8-3-5-12-22-17)21(26)19-10-7-9-18(16)25(19)29(27,28)20-11-4-6-13-23-20/h2-6,8,11-13,16,18-19H,1,7,9-10,14-15H2/t16-,18-,19+/m1/s1 |
| InChIKey | UGFJCGGWMSVTKI-QRQLOZEOSA-N |
| XLogP | 2.23 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|