C20H23FN4O3S — CID 91925939
3-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-1-(pyridin-2-ylmethyl)pyrrolidin-2-one (PubChem CID 91925939) has the molecular formula C20H23FN4O3S and a molecular weight of 418.49 g/mol. Its IUPAC name is 3-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-1-(pyridin-2-ylmethyl)pyrrolidin-2-one.
| Compound Name | 3-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-1-(pyridin-2-ylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 91925939 |
| Molecular Formula | C20H23FN4O3S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 3-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-1-(pyridin-2-ylmethyl)pyrrolidin-2-one |
| SMILES | O=C1C(N2CCN(S(=O)(=O)c3ccccc3F)CC2)CCN1Cc1ccccn1 |
| InChI | InChI=1S/C20H23FN4O3S/c21-17-6-1-2-7-19(17)29(27,28)25-13-11-23(12-14-25)18-8-10-24(20(18)26)15-16-5-3-4-9-22-16/h1-7,9,18H,8,10-15H2 |
| InChIKey | KWOPEYVEOMIKRS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |